C20H19ClN6OS — CID 121414384
(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414384) has the molecular formula C20H19ClN6OS and a molecular weight of 426.93 g/mol. Its IUPAC name is (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414384 |
| Molecular Formula | C20H19ClN6OS |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C20H19ClN6OS/c1-26(2)20(28)11-3-4-13-16(7-11)29-19-17(13)18(22-10-23-19)25-15-8-12-5-6-24-27(12)9-14(15)21/h5-6,8-11H,3-4,7H2,1-2H3,(H,22,23,25)/t11-/m0/s1 |
| InChIKey | ZKRNWQNSUFKJPQ-NSHDSACASA-N |
| XLogP | 3.93 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |