C24H28ClN7OS — CID 121414394
(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-[2-(dimethylamino)ethyl]-N-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414394) has the molecular formula C24H28ClN7OS and a molecular weight of 498.06 g/mol. Its IUPAC name is (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-[2-(dimethylamino)ethyl]-N-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-[2-(dimethylamino)ethyl]-N-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414394 |
| Molecular Formula | C24H28ClN7OS |
| Molecular Weight | 498.06 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-[2-(dimethylamino)ethyl]-N-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCN(CCN(C)C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C24H28ClN7OS/c1-4-31(10-9-30(2)3)24(33)15-5-6-17-20(11-15)34-23-21(17)22(26-14-27-23)29-19-12-16-7-8-28-32(16)13-18(19)25/h7-8,12-15H,4-6,9-11H2,1-3H3,(H,26,27,29)/t15-/m0/s1 |
| InChIKey | OLRGNYASSOIUDB-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |