C23H27N7OS — CID 121414401
(7S)-N-[2-(dimethylamino)ethyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414401) has the molecular formula C23H27N7OS and a molecular weight of 449.58 g/mol. Its IUPAC name is (7S)-N-[2-(dimethylamino)ethyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-[2-(dimethylamino)ethyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414401 |
| Molecular Formula | C23H27N7OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (7S)-N-[2-(dimethylamino)ethyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)CCN(C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4ccn5nccc5c4)c23)C1 |
| InChI | InChI=1S/C23H27N7OS/c1-28(2)10-11-29(3)23(31)15-4-5-18-19(12-15)32-22-20(18)21(24-14-25-22)27-16-7-9-30-17(13-16)6-8-26-30/h6-9,13-15H,4-5,10-12H2,1-3H3,(H,24,25,27)/t15-/m0/s1 |
| InChIKey | STOQQLPSNHSISE-HNNXBMFYSA-N |
| XLogP | 3.21 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |