C24H26N6O3S — CID 121414408
[(7S)-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone (PubChem CID 121414408) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is [(7S)-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone.
| Compound Name | [(7S)-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 121414408 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(7S)-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone |
| SMILES | COc1cn2nccc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)N1CCOC[C@@H]1C)C3 |
| InChI | InChI=1S/C24H26N6O3S/c1-14-12-33-8-7-29(14)24(31)15-3-4-17-20(9-15)34-23-21(17)22(25-13-26-23)28-18-10-16-5-6-27-30(16)11-19(18)32-2/h5-6,10-11,13-15H,3-4,7-9,12H2,1-2H3,(H,25,26,28)/t14-,15-/m0/s1 |
| InChIKey | GVRVCVKJXBIZNZ-GJZGRUSLSA-N |
| XLogP | 3.44 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |