C23H25ClN6O2S — CID 121414418
(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414418) has the molecular formula C23H25ClN6O2S and a molecular weight of 485.01 g/mol. Its IUPAC name is (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414418 |
| Molecular Formula | C23H25ClN6O2S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCN(CCOC)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C23H25ClN6O2S/c1-3-29(8-9-32-2)23(31)14-4-5-16-19(10-14)33-22-20(16)21(25-13-26-22)28-18-11-15-6-7-27-30(15)12-17(18)24/h6-7,11-14H,3-5,8-10H2,1-2H3,(H,25,26,28)/t14-/m0/s1 |
| InChIKey | HAGFJHNRECVSAC-AWEZNQCLSA-N |
| XLogP | 4.34 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |