C23H23ClN6O2S — CID 121414419
[(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3R)-3-methylmorpholin-4-yl]methanone (PubChem CID 121414419) has the molecular formula C23H23ClN6O2S and a molecular weight of 483.00 g/mol. Its IUPAC name is [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3R)-3-methylmorpholin-4-yl]methanone.
| Compound Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3R)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 121414419 |
| Molecular Formula | C23H23ClN6O2S |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3R)-3-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1COCCN1C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C23H23ClN6O2S/c1-13-11-32-7-6-29(13)23(31)14-2-3-16-19(8-14)33-22-20(16)21(25-12-26-22)28-18-9-15-4-5-27-30(15)10-17(18)24/h4-5,9-10,12-14H,2-3,6-8,11H2,1H3,(H,25,26,28)/t13-,14+/m1/s1 |
| InChIKey | XGYHCBMUEFQEGI-KGLIPLIRSA-N |
| XLogP | 4.09 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |