C22H23ClN6O2S — CID 121414427
(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414427) has the molecular formula C22H23ClN6O2S and a molecular weight of 470.99 g/mol. Its IUPAC name is (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414427 |
| Molecular Formula | C22H23ClN6O2S |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-N-ethyl-N-(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCN(CCO)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C22H23ClN6O2S/c1-2-28(7-8-30)22(31)13-3-4-15-18(9-13)32-21-19(15)20(24-12-25-21)27-17-10-14-5-6-26-29(14)11-16(17)23/h5-6,10-13,30H,2-4,7-9H2,1H3,(H,24,25,27)/t13-/m0/s1 |
| InChIKey | BSSGBZAQESTBBO-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |