C22H21ClN6O2S — CID 121414432
[(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone (PubChem CID 121414432) has the molecular formula C22H21ClN6O2S and a molecular weight of 468.97 g/mol. Its IUPAC name is [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 121414432 |
| Molecular Formula | C22H21ClN6O2S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H21ClN6O2S/c23-16-11-29-14(3-4-26-29)10-17(16)27-20-19-15-2-1-13(22(30)28-5-7-31-8-6-28)9-18(15)32-21(19)25-12-24-20/h3-4,10-13H,1-2,5-9H2,(H,24,25,27)/t13-/m0/s1 |
| InChIKey | MRABRCSZYKLRPM-ZDUSSCGKSA-N |
| XLogP | 3.70 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |