C22H24N6O2S — CID 121414458
(7S)-N-ethyl-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414458) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is (7S)-N-ethyl-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-ethyl-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414458 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (7S)-N-ethyl-4-[(6-methoxypyrazolo[1,5-a]pyridin-5-yl)amino]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCN(C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4OC)c23)C1 |
| InChI | InChI=1S/C22H24N6O2S/c1-4-27(2)22(29)13-5-6-15-18(9-13)31-21-19(15)20(23-12-24-21)26-16-10-14-7-8-25-28(14)11-17(16)30-3/h7-8,10-13H,4-6,9H2,1-3H3,(H,23,24,26)/t13-/m0/s1 |
| InChIKey | DPMVIICLHDHFSX-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |