C25H29N7O2S — CID 121414471
[(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone (PubChem CID 121414471) has the molecular formula C25H29N7O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is [(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone.
| Compound Name | [(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 121414471 |
| Molecular Formula | C25H29N7O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | [(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-methylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1COCCN1C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4N(C)C)c23)C1 |
| InChI | InChI=1S/C25H29N7O2S/c1-15-13-34-9-8-31(15)25(33)16-4-5-18-21(10-16)35-24-22(18)23(26-14-27-24)29-19-11-17-6-7-28-32(17)12-20(19)30(2)3/h6-7,11-12,14-16H,4-5,8-10,13H2,1-3H3,(H,26,27,29)/t15-,16-/m0/s1 |
| InChIKey | VBUXNDVQZSKKCY-HOTGVXAUSA-N |
| XLogP | 3.50 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |