C24H29N7OS — CID 121414584
(7S)-N-[3-(dimethylamino)propyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 121414584) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is (7S)-N-[3-(dimethylamino)propyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-[3-(dimethylamino)propyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 121414584 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | (7S)-N-[3-(dimethylamino)propyl]-N-methyl-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)CCCN(C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4ccn5nccc5c4)c23)C1 |
| InChI | InChI=1S/C24H29N7OS/c1-29(2)10-4-11-30(3)24(32)16-5-6-19-20(13-16)33-23-21(19)22(25-15-26-23)28-17-8-12-31-18(14-17)7-9-27-31/h7-9,12,14-16H,4-6,10-11,13H2,1-3H3,(H,25,26,28)/t16-/m0/s1 |
| InChIKey | HBCFBKCEBSYYGX-INIZCTEOSA-N |
| XLogP | 3.60 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |