C23H22N6O2S — CID 121414592
[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 121414592) has the molecular formula C23H22N6O2S and a molecular weight of 446.54 g/mol. Its IUPAC name is [(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 121414592 |
| Molecular Formula | C23H22N6O2S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | O=C([C@H]1CCc2c(sc3ncnc(Nc4ccn5nccc5c4)c23)C1)N1C[C@@H]2C[C@H]1CO2 |
| InChI | InChI=1S/C23H22N6O2S/c30-23(28-10-17-9-16(28)11-31-17)13-1-2-18-19(7-13)32-22-20(18)21(24-12-25-22)27-14-4-6-29-15(8-14)3-5-26-29/h3-6,8,12-13,16-17H,1-2,7,9-11H2,(H,24,25,27)/t13-,16-,17-/m0/s1 |
| InChIKey | BZZSAKHWUSWLSE-JQFCIGGWSA-N |
| XLogP | 3.19 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |