C25H29N7OS — CID 121414611
[4-(dimethylamino)piperidin-1-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 121414611) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is [4-(dimethylamino)piperidin-1-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [4-(dimethylamino)piperidin-1-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 121414611 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [4-(dimethylamino)piperidin-1-yl]-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)[C@H]2CCc3c(sc4ncnc(Nc5ccn6nccc6c5)c34)C2)CC1 |
| InChI | InChI=1S/C25H29N7OS/c1-30(2)18-7-10-31(11-8-18)25(33)16-3-4-20-21(13-16)34-24-22(20)23(26-15-27-24)29-17-6-12-32-19(14-17)5-9-28-32/h5-6,9,12,14-16,18H,3-4,7-8,10-11,13H2,1-2H3,(H,26,27,29)/t16-/m0/s1 |
| InChIKey | CATNXPDRAIRDCL-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |