C23H22N6OS — CID 121414617
3-azabicyclo[3.1.0]hexan-3-yl-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 121414617) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexan-3-yl-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | 3-azabicyclo[3.1.0]hexan-3-yl-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 121414617 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexan-3-yl-[(7S)-4-(pyrazolo[1,5-a]pyridin-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | O=C([C@H]1CCc2c(sc3ncnc(Nc4ccn5nccc5c4)c23)C1)N1CC2CC2C1 |
| InChI | InChI=1S/C23H22N6OS/c30-23(28-10-14-7-15(14)11-28)13-1-2-18-19(8-13)31-22-20(18)21(24-12-25-22)27-16-4-6-29-17(9-16)3-5-26-29/h3-6,9,12-15H,1-2,7-8,10-11H2,(H,24,25,27)/t13-,14?,15?/m0/s1 |
| InChIKey | NFXVKYJGNPONDN-NFOMZHRRSA-N |
| XLogP | 3.67 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |