C25H37N3O3S — CID 121414626
3-amino-N-(2,4-dimethylphenyl)-4-(oxan-4-ylmethylamino)-N-pentan-3-ylbenzenesulfonamide (PubChem CID 121414626) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethylphenyl)-4-(oxan-4-ylmethylamino)-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2,4-dimethylphenyl)-4-(oxan-4-ylmethylamino)-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 121414626 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 3-amino-N-(2,4-dimethylphenyl)-4-(oxan-4-ylmethylamino)-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCC(CC)N(c1ccc(C)cc1C)S(=O)(=O)c1ccc(NCC2CCOCC2)c(N)c1 |
| InChI | InChI=1S/C25H37N3O3S/c1-5-21(6-2)28(25-10-7-18(3)15-19(25)4)32(29,30)22-8-9-24(23(26)16-22)27-17-20-11-13-31-14-12-20/h7-10,15-16,20-21,27H,5-6,11-14,17,26H2,1-4H3 |
| InChIKey | LWTAUHKOFAXVMG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|