C27H20F5N7O3 — CID 121414784
1-[2-(2-methoxyphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 121414784) has the molecular formula C27H20F5N7O3 and a molecular weight of 585.49 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[2-(2-methoxyphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 121414784 |
| Molecular Formula | C27H20F5N7O3 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)pyrazol-3-yl]-3-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | COc1ccccc1-n1nccc1NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C27H20F5N7O3/c1-41-22-5-3-2-4-21(22)39-23(14-15-34-39)36-25(40)35-18-8-6-17(7-9-18)24-33-16-38(37-24)19-10-12-20(13-11-19)42-27(31,32)26(28,29)30/h2-16H,1H3,(H2,35,36,40) |
| InChIKey | NGBNUZOTHDWEKS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|