C5H8Br2Cl4 — CID 121414873
1,2-dibromopropane;1,1,1,2-tetrachloroethane (PubChem CID 121414873) has the molecular formula C5H8Br2Cl4 and a molecular weight of 369.74 g/mol. Its IUPAC name is 1,2-dibromopropane;1,1,1,2-tetrachloroethane.
| Compound Name | 1,2-dibromopropane;1,1,1,2-tetrachloroethane |
|---|---|
| PubChem CID | 121414873 |
| Molecular Formula | C5H8Br2Cl4 |
| Molecular Weight | 369.74 g/mol |
| Exact Mass | 365.77 |
| IUPAC Name | 1,2-dibromopropane;1,1,1,2-tetrachloroethane |
| SMILES | CC(Br)CBr.ClCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H6Br2.C2H2Cl4/c1-3(5)2-4;3-1-2(4,5)6/h3H,2H2,1H3;1H2 |
| InChIKey | GLEUMFYQVGBQEJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|