C23H22F2N2O4S — CID 121414909
(3S,6R)-2-[[2,5-difluoro-4-[1-(2-oxo-1,3-oxazolidin-5-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione (PubChem CID 121414909) has the molecular formula C23H22F2N2O4S and a molecular weight of 460.50 g/mol. Its IUPAC name is (3S,6R)-2-[[2,5-difluoro-4-[1-(2-oxo-1,3-oxazolidin-5-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione.
| Compound Name | (3S,6R)-2-[[2,5-difluoro-4-[1-(2-oxo-1,3-oxazolidin-5-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione |
|---|---|
| PubChem CID | 121414909 |
| Molecular Formula | C23H22F2N2O4S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (3S,6R)-2-[[2,5-difluoro-4-[1-(2-oxo-1,3-oxazolidin-5-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione |
| SMILES | CC(c1cc(F)c(CN2S[C@H](c3ccccc3)C(=O)C(=O)[C@@H]2C)cc1F)C1CNC(=O)O1 |
| InChI | InChI=1S/C23H22F2N2O4S/c1-12(19-10-26-23(30)31-19)16-9-17(24)15(8-18(16)25)11-27-13(2)20(28)21(29)22(32-27)14-6-4-3-5-7-14/h3-9,12-13,19,22H,10-11H2,1-2H3,(H,26,30)/t12?,13-,19?,22+/m0/s1 |
| InChIKey | XIEXZOMVMLUBOU-GFRIRGRRSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|