C21H21F2N3O4S — CID 121414917
5-[[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]methyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 121414917) has the molecular formula C21H21F2N3O4S and a molecular weight of 449.48 g/mol. Its IUPAC name is 5-[[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]methyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]methyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 121414917 |
| Molecular Formula | C21H21F2N3O4S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]methyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(Cc2n[nH]c(=O)o2)cc1F |
| InChI | InChI=1S/C21H21F2N3O4S/c1-13-7-8-19(14-5-3-2-4-6-14)31(28,29)26(13)12-16-10-17(22)15(9-18(16)23)11-20-24-25-21(27)30-20/h2-6,9-10,13,19H,7-8,11-12H2,1H3,(H,25,27)/t13-,19+/m0/s1 |
| InChIKey | NWKRTRFXIDCEBT-ORAYPTAESA-N |
| XLogP | 3.29 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |