C23H22F2N4O3S — CID 121414919
(3S,6R)-2-[[2,5-difluoro-4-[1-(2-methyl-3-oxo-1,2,4-triazol-1-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione (PubChem CID 121414919) has the molecular formula C23H22F2N4O3S and a molecular weight of 472.52 g/mol. Its IUPAC name is (3S,6R)-2-[[2,5-difluoro-4-[1-(2-methyl-3-oxo-1,2,4-triazol-1-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione.
| Compound Name | (3S,6R)-2-[[2,5-difluoro-4-[1-(2-methyl-3-oxo-1,2,4-triazol-1-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione |
|---|---|
| PubChem CID | 121414919 |
| Molecular Formula | C23H22F2N4O3S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (3S,6R)-2-[[2,5-difluoro-4-[1-(2-methyl-3-oxo-1,2,4-triazol-1-yl)ethyl]phenyl]methyl]-3-methyl-6-phenylthiazinane-4,5-dione |
| SMILES | CC(c1cc(F)c(CN2S[C@H](c3ccccc3)C(=O)C(=O)[C@@H]2C)cc1F)n1cnc(=O)n1C |
| InChI | InChI=1S/C23H22F2N4O3S/c1-13(28-12-26-23(32)27(28)3)17-10-18(24)16(9-19(17)25)11-29-14(2)20(30)21(31)22(33-29)15-7-5-4-6-8-15/h4-10,12-14,22H,11H2,1-3H3/t13?,14-,22+/m0/s1 |
| InChIKey | MEDYQKZIWMLDPT-ONJCSVGOSA-N |
| XLogP | 3.20 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|