C12H15N5 — CID 121415433
1-pyrido[3,4-b]pyrazin-5-ylpiperidin-4-amine (PubChem CID 121415433) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 1-pyrido[3,4-b]pyrazin-5-ylpiperidin-4-amine.
| Compound Name | 1-pyrido[3,4-b]pyrazin-5-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 121415433 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-pyrido[3,4-b]pyrazin-5-ylpiperidin-4-amine |
| SMILES | NC1CCN(c2nccc3nccnc23)CC1 |
| InChI | InChI=1S/C12H15N5/c13-9-2-7-17(8-3-9)12-11-10(1-4-16-12)14-5-6-15-11/h1,4-6,9H,2-3,7-8,13H2 |
| InChIKey | VPXNQHKEOXWFBE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |