C24H27FN4O3 — CID 121415456
4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-7,8-dihydro-5H-pyrano[4,3-b]pyran-2-one (PubChem CID 121415456) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-7,8-dihydro-5H-pyrano[4,3-b]pyran-2-one.
| Compound Name | 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-7,8-dihydro-5H-pyrano[4,3-b]pyran-2-one |
|---|---|
| PubChem CID | 121415456 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-7,8-dihydro-5H-pyrano[4,3-b]pyran-2-one |
| SMILES | O=c1cc(NCCCN2CCN(c3nccc4ccc(F)cc34)CC2)c2c(o1)CCOC2 |
| InChI | InChI=1S/C24H27FN4O3/c25-18-3-2-17-4-7-27-24(19(17)14-18)29-11-9-28(10-12-29)8-1-6-26-21-15-23(30)32-22-5-13-31-16-20(21)22/h2-4,7,14-15,26H,1,5-6,8-13,16H2 |
| InChIKey | VZYVBNMAUUYIHP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|