C24H22F3N5O3 — CID 121415509
4-[[3-[4-(3,7-difluoroisoquinolin-1-yl)piperazin-1-yl]-2-hydroxypropyl]amino]-6-fluoro-1,3-benzoxazin-2-one (PubChem CID 121415509) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is 4-[[3-[4-(3,7-difluoroisoquinolin-1-yl)piperazin-1-yl]-2-hydroxypropyl]amino]-6-fluoro-1,3-benzoxazin-2-one.
| Compound Name | 4-[[3-[4-(3,7-difluoroisoquinolin-1-yl)piperazin-1-yl]-2-hydroxypropyl]amino]-6-fluoro-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 121415509 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-[[3-[4-(3,7-difluoroisoquinolin-1-yl)piperazin-1-yl]-2-hydroxypropyl]amino]-6-fluoro-1,3-benzoxazin-2-one |
| SMILES | O=c1nc(NCC(O)CN2CCN(c3nc(F)cc4ccc(F)cc34)CC2)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C24H22F3N5O3/c25-15-2-1-14-9-21(27)29-23(18(14)10-15)32-7-5-31(6-8-32)13-17(33)12-28-22-19-11-16(26)3-4-20(19)35-24(34)30-22/h1-4,9-11,17,33H,5-8,12-13H2,(H,28,30,34) |
| InChIKey | VVEJKTJFDNJXPE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|