About 2H-[1,3]thiazolo[5,4-c][1]benzazepine
2H-[1,3]thiazolo[5,4-c][1]benzazepine (PubChem CID 121416108) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 2H-[1,3]thiazolo[5,4-c][1]benzazepine.
Molecular Properties
| Compound Name | 2H-[1,3]thiazolo[5,4-c][1]benzazepine |
| PubChem CID | 121416108 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2H-[1,3]thiazolo[5,4-c][1]benzazepine |
| SMILES | C1=C2SCN=C2C=c2ccccc2=N1 |
| InChI | InChI=1S/C11H8N2S/c1-2-4-9-8(3-1)5-10-11(6-12-9)14-7-13-10/h1-6H,7H2 |
| InChIKey | NEBJDOSOENWGHE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-[1,3]thiazolo[5,4-c][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-[1,3]thiazolo[5,4-c][1]benzazepine?
The IUPAC name of 2H-[1,3]thiazolo[5,4-c][1]benzazepine (CID 121416108) is 2H-[1,3]thiazolo[5,4-c][1]benzazepine.
What is the SMILES notation for 2H-[1,3]thiazolo[5,4-c][1]benzazepine?
The canonical SMILES for 2H-[1,3]thiazolo[5,4-c][1]benzazepine is C1=C2SCN=C2C=c2ccccc2=N1.
What is the InChIKey of 2H-[1,3]thiazolo[5,4-c][1]benzazepine?
The InChIKey is NEBJDOSOENWGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-4-9-8(3-1)5-10-11(6-12-9)14-7-13-10/h1-6H,7H2.
What are the key properties of 2H-[1,3]thiazolo[5,4-c][1]benzazepine?
2H-[1,3]thiazolo[5,4-c][1]benzazepine has a molecular weight of 200.27 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-[1,3]thiazolo[5,4-c][1]benzazepine is sourced from PubChem (CID 121416108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).