C39H30N3O7P — CID 121416140
tris[2-(phenylcarbamoyl)phenyl] phosphate (PubChem CID 121416140) has the molecular formula C39H30N3O7P and a molecular weight of 683.66 g/mol. Its IUPAC name is tris[2-(phenylcarbamoyl)phenyl] phosphate.
| Compound Name | tris[2-(phenylcarbamoyl)phenyl] phosphate |
|---|---|
| PubChem CID | 121416140 |
| Molecular Formula | C39H30N3O7P |
| Molecular Weight | 683.66 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | tris[2-(phenylcarbamoyl)phenyl] phosphate |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OP(=O)(Oc1ccccc1C(=O)Nc1ccccc1)Oc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C39H30N3O7P/c43-37(40-28-16-4-1-5-17-28)31-22-10-13-25-34(31)47-50(46,48-35-26-14-11-23-32(35)38(44)41-29-18-6-2-7-19-29)49-36-27-15-12-24-33(36)39(45)42-30-20-8-3-9-21-30/h1-27H,(H,40,43)(H,41,44)(H,42,45) |
| InChIKey | ZHPTWEBPKYJURE-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.66 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|