C19H24F3NO4 — CID 121416204
2,2,2-trifluoro-N-[3-(oxan-2-yloxy)-1-phenyl-2-prop-2-enoxypropyl]acetamide (PubChem CID 121416204) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(oxan-2-yloxy)-1-phenyl-2-prop-2-enoxypropyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(oxan-2-yloxy)-1-phenyl-2-prop-2-enoxypropyl]acetamide |
|---|---|
| PubChem CID | 121416204 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(oxan-2-yloxy)-1-phenyl-2-prop-2-enoxypropyl]acetamide |
| SMILES | C=CCOC(COC1CCCCO1)C(NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H24F3NO4/c1-2-11-25-15(13-27-16-10-6-7-12-26-16)17(14-8-4-3-5-9-14)23-18(24)19(20,21)22/h2-5,8-9,15-17H,1,6-7,10-13H2,(H,23,24) |
| InChIKey | MOXTVARJPZMKEM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|