C19H22N6O2 — CID 121416358
(5S)-13-ethyl-5-phenyl-7-oxa-2,4,10,13,14,18-hexazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one (PubChem CID 121416358) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (5S)-13-ethyl-5-phenyl-7-oxa-2,4,10,13,14,18-hexazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one.
| Compound Name | (5S)-13-ethyl-5-phenyl-7-oxa-2,4,10,13,14,18-hexazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
|---|---|
| PubChem CID | 121416358 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5S)-13-ethyl-5-phenyl-7-oxa-2,4,10,13,14,18-hexazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
| SMILES | CCn1ncc2cc3nc(c21)NCCOC[C@H](c1ccccc1)NC(=O)N3 |
| InChI | InChI=1S/C19H22N6O2/c1-2-25-17-14(11-21-25)10-16-23-18(17)20-8-9-27-12-15(22-19(26)24-16)13-6-4-3-5-7-13/h3-7,10-11,15H,2,8-9,12H2,1H3,(H3,20,22,23,24,26)/t15-/m1/s1 |
| InChIKey | JVTHXSIRYSQHTL-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |