C19H21N5O2 — CID 121416436
(5S)-13-methyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one (PubChem CID 121416436) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is (5S)-13-methyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one.
| Compound Name | (5S)-13-methyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
|---|---|
| PubChem CID | 121416436 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (5S)-13-methyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
| SMILES | Cn1ncc2cc3nc(c21)CCCOC[C@H](c1ccccc1)NC(=O)N3 |
| InChI | InChI=1S/C19H21N5O2/c1-24-18-14(11-20-24)10-17-21-15(18)8-5-9-26-12-16(22-19(25)23-17)13-6-3-2-4-7-13/h2-4,6-7,10-11,16H,5,8-9,12H2,1H3,(H2,21,22,23,25)/t16-/m1/s1 |
| InChIKey | BHKSQASETWLPNC-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |