About [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride
[4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride (PubChem CID 121416771) has the molecular formula C9H18ClF2NO2
and a molecular weight of 245.70 g/mol. Its IUPAC name is [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride |
| PubChem CID | 121416771 |
| Molecular Formula | C9H18ClF2NO2 |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCC(OCF)(OCF)CC1 |
| InChI | InChI=1S/C9H17F2NO2.ClH/c10-6-13-9(14-7-11)3-1-8(5-12)2-4-9;/h8H,1-7,12H2;1H |
| InChIKey | OWNVKCBMDOSCJW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride?
The IUPAC name of [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride (CID 121416771) is [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride.
What is the SMILES notation for [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride?
The canonical SMILES for [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride is Cl.NCC1CCC(OCF)(OCF)CC1.
What is the InChIKey of [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride?
The InChIKey is OWNVKCBMDOSCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2.ClH/c10-6-13-9(14-7-11)3-1-8(5-12)2-4-9;/h8H,1-7,12H2;1H.
What are the key properties of [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride?
[4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride has a molecular weight of 245.70 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-bis(fluoromethoxy)cyclohexyl]methanamine;hydrochloride is sourced from PubChem (CID 121416771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).