About N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide
N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide (PubChem CID 121416909) has the molecular formula C21H27N7O
and a molecular weight of 393.50 g/mol. Its IUPAC name is N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide |
| PubChem CID | 121416909 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide |
| SMILES | CCN(CCN(CC)c1nc(C)cc(C)n1)C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C21H27N7O/c1-5-26(13-14-27(6-2)21-24-16(3)15-17(4)25-21)20(29)18-9-7-8-10-19(18)28-22-11-12-23-28/h7-12,15H,5-6,13-14H2,1-4H3 |
| InChIKey | VACXGDAMAVWGEM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide?
The IUPAC name of N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide (CID 121416909) is N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide.
What is the SMILES notation for N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide?
The canonical SMILES for N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide is CCN(CCN(CC)c1nc(C)cc(C)n1)C(=O)c1ccccc1-n1nccn1.
What is the InChIKey of N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide?
The InChIKey is VACXGDAMAVWGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N7O/c1-5-26(13-14-27(6-2)21-24-16(3)15-17(4)25-21)20(29)18-9-7-8-10-19(18)28-22-11-12-23-28/h7-12,15H,5-6,13-14H2,1-4H3.
What are the key properties of N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide?
N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide has a molecular weight of 393.50 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]ethyl]-N-ethyl-2-(triazol-2-yl)benzamide is sourced from PubChem (CID 121416909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).