About N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide
N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide (PubChem CID 121416940) has the molecular formula C20H28N4O2
and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide.
Molecular Properties
| Compound Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide |
| PubChem CID | 121416940 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide |
| SMILES | CCOc1ccccc1C(=O)N(CC)CCN(C)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C20H28N4O2/c1-6-24(19(25)17-10-8-9-11-18(17)26-7-2)13-12-23(5)20-21-15(3)14-16(4)22-20/h8-11,14H,6-7,12-13H2,1-5H3 |
| InChIKey | JCBRAODYZJUEIE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide?
The IUPAC name of N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide (CID 121416940) is N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide.
What is the SMILES notation for N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide?
The canonical SMILES for N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide is CCOc1ccccc1C(=O)N(CC)CCN(C)c1nc(C)cc(C)n1.
What is the InChIKey of N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide?
The InChIKey is JCBRAODYZJUEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2/c1-6-24(19(25)17-10-8-9-11-18(17)26-7-2)13-12-23(5)20-21-15(3)14-16(4)22-20/h8-11,14H,6-7,12-13H2,1-5H3.
What are the key properties of N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide?
N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide has a molecular weight of 356.47 g/mol, XLogP of 3.09, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,6-dimethylpyrimidin-2-yl)-methylamino]ethyl]-2-ethoxy-N-ethylbenzamide is sourced from PubChem (CID 121416940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).