C22H21F3N4O — CID 121417253
2-[(3aR,7aR)-6-[2-(2,2,2-trifluoroethyl)benzoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]pyridine-4-carbonitrile (PubChem CID 121417253) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-[(3aR,7aR)-6-[2-(2,2,2-trifluoroethyl)benzoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[(3aR,7aR)-6-[2-(2,2,2-trifluoroethyl)benzoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 121417253 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[(3aR,7aR)-6-[2-(2,2,2-trifluoroethyl)benzoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CC[C@@H]3CCN(C(=O)c4ccccc4CC(F)(F)F)C[C@@H]32)c1 |
| InChI | InChI=1S/C22H21F3N4O/c23-22(24,25)12-17-3-1-2-4-18(17)21(30)28-9-6-16-7-10-29(19(16)14-28)20-11-15(13-26)5-8-27-20/h1-5,8,11,16,19H,6-7,9-10,12,14H2/t16-,19-/m0/s1 |
| InChIKey | DNORLDWYSHAMGY-LPHOPBHVSA-N |
| XLogP | 3.80 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |