C24H28FN5O2 — CID 121417653
4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-5,6,7,8-tetrahydropyrano[3,2-c]pyridin-2-one (PubChem CID 121417653) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-5,6,7,8-tetrahydropyrano[3,2-c]pyridin-2-one.
| Compound Name | 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-5,6,7,8-tetrahydropyrano[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 121417653 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-[3-[4-(7-fluoroisoquinolin-1-yl)piperazin-1-yl]propylamino]-5,6,7,8-tetrahydropyrano[3,2-c]pyridin-2-one |
| SMILES | O=c1cc(NCCCN2CCN(c3nccc4ccc(F)cc34)CC2)c2c(o1)CCNC2 |
| InChI | InChI=1S/C24H28FN5O2/c25-18-3-2-17-4-8-28-24(19(17)14-18)30-12-10-29(11-13-30)9-1-6-27-21-15-23(31)32-22-5-7-26-16-20(21)22/h2-4,8,14-15,26-27H,1,5-7,9-13,16H2 |
| InChIKey | VDONAVXHUBXBTE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|