C5H5N3O4 — CID 121419597
1-(1-hydroxyethenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 121419597) has the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. Its IUPAC name is 1-(1-hydroxyethenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1-hydroxyethenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121419597 |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 1-(1-hydroxyethenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C(O)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H5N3O4/c1-2(9)8-4(11)6-3(10)7-5(8)12/h9H,1H2,(H2,6,7,10,11,12) |
| InChIKey | LBIFGVOPILBRII-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|