About (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine
(1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine (PubChem CID 121419679) has the molecular formula C19H17F6NO
and a molecular weight of 389.34 g/mol. Its IUPAC name is (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine |
| PubChem CID | 121419679 |
| Molecular Formula | C19H17F6NO |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine |
| SMILES | C=C[C@@](N)(O[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H17F6NO/c1-3-17(26,14-7-5-4-6-8-14)27-12(2)13-9-15(18(20,21)22)11-16(10-13)19(23,24)25/h3-12H,1,26H2,2H3/t12-,17-/m1/s1 |
| InChIKey | BFUCZPPJOSZXND-SJKOYZFVSA-N |
| XLogP | 5.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine?
The IUPAC name of (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine (CID 121419679) is (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine.
What is the SMILES notation for (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine?
The canonical SMILES for (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine is C=C[C@@](N)(O[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine?
The InChIKey is BFUCZPPJOSZXND-SJKOYZFVSA-N. The full InChI is InChI=1S/C19H17F6NO/c1-3-17(26,14-7-5-4-6-8-14)27-12(2)13-9-15(18(20,21)22)11-16(10-13)19(23,24)25/h3-12H,1,26H2,2H3/t12-,17-/m1/s1.
What are the key properties of (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine?
(1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine has a molecular weight of 389.34 g/mol, XLogP of 5.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylprop-2-en-1-amine is sourced from PubChem (CID 121419679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).