C11H19NO3 — CID 121419683
(3R,7aS)-3-tert-butyl-1-hydroxy-7a-methyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 121419683) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (3R,7aS)-3-tert-butyl-1-hydroxy-7a-methyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,7aS)-3-tert-butyl-1-hydroxy-7a-methyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 121419683 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (3R,7aS)-3-tert-butyl-1-hydroxy-7a-methyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)(C)[C@H]1OC(O)[C@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C11H19NO3/c1-10(2,3)8-12-7(13)5-6-11(12,4)9(14)15-8/h8-9,14H,5-6H2,1-4H3/t8-,9?,11+/m1/s1 |
| InChIKey | QKWMMLMQQODYIC-RTVRGBPTSA-N |
| XLogP | 1.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |