About [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine
[4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine (PubChem CID 121419755) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine |
| PubChem CID | 121419755 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine |
| SMILES | C/C=C/C1=C(NN)COCC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-3-7-4-5-11-6-8(7)10-9/h2-3,10H,4-6,9H2,1H3/b3-2+ |
| InChIKey | IJUBRSMDUGPQQR-NSCUHMNNSA-N |
| XLogP | 0.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine?
The IUPAC name of [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine (CID 121419755) is [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine.
What is the SMILES notation for [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine?
The canonical SMILES for [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine is C/C=C/C1=C(NN)COCC1.
What is the InChIKey of [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine?
The InChIKey is IJUBRSMDUGPQQR-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-3-7-4-5-11-6-8(7)10-9/h2-3,10H,4-6,9H2,1H3/b3-2+.
What are the key properties of [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine?
[4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine has a molecular weight of 154.21 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-5-yl]hydrazine is sourced from PubChem (CID 121419755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).