About O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine
O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine (PubChem CID 121419762) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine.
Molecular Properties
| Compound Name | O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine |
| PubChem CID | 121419762 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine |
| SMILES | C/C=C/C1=C(ON)CCCO1 |
| InChI | InChI=1S/C8H13NO2/c1-2-4-7-8(11-9)5-3-6-10-7/h2,4H,3,5-6,9H2,1H3/b4-2+ |
| InChIKey | URWHTAJQIVYILC-DUXPYHPUSA-N |
| XLogP | 1.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine?
The IUPAC name of O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine (CID 121419762) is O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine.
What is the SMILES notation for O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine?
The canonical SMILES for O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine is C/C=C/C1=C(ON)CCCO1.
What is the InChIKey of O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine?
The InChIKey is URWHTAJQIVYILC-DUXPYHPUSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-4-7-8(11-9)5-3-6-10-7/h2,4H,3,5-6,9H2,1H3/b4-2+.
What are the key properties of O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine?
O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine has a molecular weight of 155.20 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyran-5-yl]hydroxylamine is sourced from PubChem (CID 121419762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).