About 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane
3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 121419912) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane |
| PubChem CID | 121419912 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | C=C1COC2(CCNCC2)CN1 |
| InChI | InChI=1S/C9H16N2O/c1-8-6-12-9(7-11-8)2-4-10-5-3-9/h10-11H,1-7H2 |
| InChIKey | NLSGGJJTEFBNCH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane?
The IUPAC name of 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane (CID 121419912) is 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane?
The canonical SMILES for 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane is C=C1COC2(CCNCC2)CN1.
What is the InChIKey of 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane?
The InChIKey is NLSGGJJTEFBNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-8-6-12-9(7-11-8)2-4-10-5-3-9/h10-11H,1-7H2.
What are the key properties of 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane?
3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane has a molecular weight of 168.24 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-1-oxa-4,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 121419912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).