About 5-buta-1,3-dien-2-yl-1H-imidazole
5-buta-1,3-dien-2-yl-1H-imidazole (PubChem CID 121420097) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-1H-imidazole.
Molecular Properties
| Compound Name | 5-buta-1,3-dien-2-yl-1H-imidazole |
| PubChem CID | 121420097 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-1H-imidazole |
| SMILES | C=CC(=C)c1cnc[nH]1 |
| InChI | InChI=1S/C7H8N2/c1-3-6(2)7-4-8-5-9-7/h3-5H,1-2H2,(H,8,9) |
| InChIKey | LBSMTTYLZOXNPW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-buta-1,3-dien-2-yl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-buta-1,3-dien-2-yl-1H-imidazole?
The IUPAC name of 5-buta-1,3-dien-2-yl-1H-imidazole (CID 121420097) is 5-buta-1,3-dien-2-yl-1H-imidazole.
What is the SMILES notation for 5-buta-1,3-dien-2-yl-1H-imidazole?
The canonical SMILES for 5-buta-1,3-dien-2-yl-1H-imidazole is C=CC(=C)c1cnc[nH]1.
What is the InChIKey of 5-buta-1,3-dien-2-yl-1H-imidazole?
The InChIKey is LBSMTTYLZOXNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-3-6(2)7-4-8-5-9-7/h3-5H,1-2H2,(H,8,9).
What are the key properties of 5-buta-1,3-dien-2-yl-1H-imidazole?
5-buta-1,3-dien-2-yl-1H-imidazole has a molecular weight of 120.15 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-buta-1,3-dien-2-yl-1H-imidazole is sourced from PubChem (CID 121420097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).