About N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine
N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine (PubChem CID 121420130) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine.
Molecular Properties
| Compound Name | N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine |
| PubChem CID | 121420130 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine |
| SMILES | CCCCC/C(=C/CNCNC(C)C)CC |
| InChI | InChI=1S/C14H30N2/c1-5-7-8-9-14(6-2)10-11-15-12-16-13(3)4/h10,13,15-16H,5-9,11-12H2,1-4H3/b14-10+ |
| InChIKey | VFMCVVQIPSAYDK-GXDHUFHOSA-N |
| XLogP | 3.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine?
The IUPAC name of N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine (CID 121420130) is N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine.
What is the SMILES notation for N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine?
The canonical SMILES for N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine is CCCCC/C(=C/CNCNC(C)C)CC.
What is the InChIKey of N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine?
The InChIKey is VFMCVVQIPSAYDK-GXDHUFHOSA-N. The full InChI is InChI=1S/C14H30N2/c1-5-7-8-9-14(6-2)10-11-15-12-16-13(3)4/h10,13,15-16H,5-9,11-12H2,1-4H3/b14-10+.
What are the key properties of N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine?
N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine has a molecular weight of 226.41 g/mol, XLogP of 3.45, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-ethyloct-2-enyl]-N'-propan-2-ylmethanediamine is sourced from PubChem (CID 121420130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).