About prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate
prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 121420132) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
| PubChem CID | 121420132 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-10-18-13(17)15-9-5-6-11(15)12(16)14-7-3-4-8-14/h2,11H,1,3-10H2/t11-/m0/s1 |
| InChIKey | OPQFRHNSIQHFRS-NSHDSACASA-N |
| XLogP | 1.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate (CID 121420132) is prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1CCC[C@H]1C(=O)N1CCCC1.
What is the InChIKey of prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate?
The InChIKey is OPQFRHNSIQHFRS-NSHDSACASA-N. The full InChI is InChI=1S/C13H20N2O3/c1-2-10-18-13(17)15-9-5-6-11(15)12(16)14-7-3-4-8-14/h2,11H,1,3-10H2/t11-/m0/s1.
What are the key properties of prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate has a molecular weight of 252.31 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 121420132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).