C13H20N2O3 — CID 121420132
prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 121420132) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121420132 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | prop-2-enyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-10-18-13(17)15-9-5-6-11(15)12(16)14-7-3-4-8-14/h2,11H,1,3-10H2/t11-/m0/s1 |
| InChIKey | OPQFRHNSIQHFRS-NSHDSACASA-N |
| XLogP | 1.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|