About 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole
4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole (PubChem CID 121420142) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole |
| PubChem CID | 121420142 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole |
| SMILES | C=C(C)C1=CNCN1 |
| InChI | InChI=1S/C6H10N2/c1-5(2)6-3-7-4-8-6/h3,7-8H,1,4H2,2H3 |
| InChIKey | XHASMZOZSVYOCK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole?
The IUPAC name of 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole (CID 121420142) is 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole.
What is the SMILES notation for 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole?
The canonical SMILES for 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole is C=C(C)C1=CNCN1.
What is the InChIKey of 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole?
The InChIKey is XHASMZOZSVYOCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-5(2)6-3-7-4-8-6/h3,7-8H,1,4H2,2H3.
What are the key properties of 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole?
4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole has a molecular weight of 110.16 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-en-2-yl-2,3-dihydro-1H-imidazole is sourced from PubChem (CID 121420142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).