About N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine
N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine (PubChem CID 121420145) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine.
Molecular Properties
| Compound Name | N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine |
| PubChem CID | 121420145 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine |
| SMILES | C=C(C)/C=C\CNCNC |
| InChI | InChI=1S/C8H16N2/c1-8(2)5-4-6-10-7-9-3/h4-5,9-10H,1,6-7H2,2-3H3/b5-4- |
| InChIKey | AIQXDFKSXYYXIF-PLNGDYQASA-N |
| XLogP | 0.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine?
The IUPAC name of N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine (CID 121420145) is N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine.
What is the SMILES notation for N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine?
The canonical SMILES for N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine is C=C(C)/C=C\CNCNC.
What is the InChIKey of N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine?
The InChIKey is AIQXDFKSXYYXIF-PLNGDYQASA-N. The full InChI is InChI=1S/C8H16N2/c1-8(2)5-4-6-10-7-9-3/h4-5,9-10H,1,6-7H2,2-3H3/b5-4-.
What are the key properties of N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine?
N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine has a molecular weight of 140.23 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[(2Z)-4-methylpenta-2,4-dienyl]methanediamine is sourced from PubChem (CID 121420145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).