About N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine
N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine (PubChem CID 121420147) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine.
Molecular Properties
| Compound Name | N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine |
| PubChem CID | 121420147 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine |
| SMILES | C=C/C=C\C(C)NCNC |
| InChI | InChI=1S/C8H16N2/c1-4-5-6-8(2)10-7-9-3/h4-6,8-10H,1,7H2,2-3H3/b6-5- |
| InChIKey | HADOGZQLWDWIFU-WAYWQWQTSA-N |
| XLogP | 0.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine?
The IUPAC name of N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine (CID 121420147) is N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine.
What is the SMILES notation for N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine?
The canonical SMILES for N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine is C=C/C=C\C(C)NCNC.
What is the InChIKey of N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine?
The InChIKey is HADOGZQLWDWIFU-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H16N2/c1-4-5-6-8(2)10-7-9-3/h4-6,8-10H,1,7H2,2-3H3/b6-5-.
What are the key properties of N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine?
N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine has a molecular weight of 140.23 g/mol, XLogP of 0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3Z)-hexa-3,5-dien-2-yl]-N-methylmethanediamine is sourced from PubChem (CID 121420147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).