About N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide
N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide (PubChem CID 121420160) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide.
Molecular Properties
| Compound Name | N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide |
| PubChem CID | 121420160 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide |
| SMILES | CC/C(C)=C/C=C/C/N=C/N(C)N |
| InChI | InChI=1S/C10H19N3/c1-4-10(2)7-5-6-8-12-9-13(3)11/h5-7,9H,4,8,11H2,1-3H3/b6-5+,10-7+,12-9+ |
| InChIKey | SJODJEORSOPTPY-QHPVFSOISA-N |
| XLogP | 1.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide?
The IUPAC name of N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide (CID 121420160) is N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide.
What is the SMILES notation for N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide?
The canonical SMILES for N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide is CC/C(C)=C/C=C/C/N=C/N(C)N.
What is the InChIKey of N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide?
The InChIKey is SJODJEORSOPTPY-QHPVFSOISA-N. The full InChI is InChI=1S/C10H19N3/c1-4-10(2)7-5-6-8-12-9-13(3)11/h5-7,9H,4,8,11H2,1-3H3/b6-5+,10-7+,12-9+.
What are the key properties of N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide?
N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide has a molecular weight of 181.28 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-methyl-N'-[(2E,4E)-5-methylhepta-2,4-dienyl]methanimidamide is sourced from PubChem (CID 121420160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).