C15H26N2 — CID 121420218
(1R,4aR,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,5,6-tetrahydronaphthalene-4a,8a-diamine (PubChem CID 121420218) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (1R,4aR,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,5,6-tetrahydronaphthalene-4a,8a-diamine.
| Compound Name | (1R,4aR,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,5,6-tetrahydronaphthalene-4a,8a-diamine |
|---|---|
| PubChem CID | 121420218 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (1R,4aR,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,5,6-tetrahydronaphthalene-4a,8a-diamine |
| SMILES | CC1=C[C@]2(N)[C@@H](C(C)C)CC=C(C)[C@]2(N)CC1 |
| InChI | InChI=1S/C15H26N2/c1-10(2)13-6-5-12(4)14(16)8-7-11(3)9-15(13,14)17/h5,9-10,13H,6-8,16-17H2,1-4H3/t13-,14-,15+/m1/s1 |
| InChIKey | RIJYYEHOHAKPQM-KFWWJZLASA-N |
| XLogP | 2.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|