About 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole
2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 121420301) has the molecular formula C25H16S4
and a molecular weight of 444.67 g/mol. Its IUPAC name is 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole |
| PubChem CID | 121420301 |
| Molecular Formula | C25H16S4 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | CC=Cc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5cccs5)cc4sc32)s1 |
| InChI | InChI=1S/C25H16S4/c1-2-4-17-8-11-21(27-17)16-7-10-19-23(14-16)29-24-18-9-6-15(20-5-3-12-26-20)13-22(18)28-25(19)24/h2-14H,1H3 |
| InChIKey | HBQVQCITSJVXMA-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole?
The IUPAC name of 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole (CID 121420301) is 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole.
What is the SMILES notation for 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole?
The canonical SMILES for 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole is CC=Cc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5cccs5)cc4sc32)s1.
What is the InChIKey of 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole?
The InChIKey is HBQVQCITSJVXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16S4/c1-2-4-17-8-11-21(27-17)16-7-10-19-23(14-16)29-24-18-9-6-15(20-5-3-12-26-20)13-22(18)28-25(19)24/h2-14H,1H3.
What are the key properties of 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole?
2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole has a molecular weight of 444.67 g/mol, XLogP of 9.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-prop-1-enylthiophen-2-yl)-7-thiophen-2-yl-[1]benzothiolo[3,2-b][1]benzothiole is sourced from PubChem (CID 121420301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).