C32H37NO — CID 121420343
10'-cyclohexa-2,4-dien-1-ylspiro[1,2,3,4,5,6,7,8-octahydroanthracene-10,9'-1,2,3,4,5,6-hexahydroacridine]-9-one (PubChem CID 121420343) has the molecular formula C32H37NO and a molecular weight of 451.65 g/mol. Its IUPAC name is 10'-cyclohexa-2,4-dien-1-ylspiro[1,2,3,4,5,6,7,8-octahydroanthracene-10,9'-1,2,3,4,5,6-hexahydroacridine]-9-one.
| Compound Name | 10'-cyclohexa-2,4-dien-1-ylspiro[1,2,3,4,5,6,7,8-octahydroanthracene-10,9'-1,2,3,4,5,6-hexahydroacridine]-9-one |
|---|---|
| PubChem CID | 121420343 |
| Molecular Formula | C32H37NO |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 10'-cyclohexa-2,4-dien-1-ylspiro[1,2,3,4,5,6,7,8-octahydroanthracene-10,9'-1,2,3,4,5,6-hexahydroacridine]-9-one |
| SMILES | O=C1C2=C(CCCC2)C2(C3=C(CCC=C3)N(C3C=CC=CC3)C3=C2CCCC3)C2=C1CCCC2 |
| InChI | InChI=1S/C32H37NO/c34-31-23-14-4-6-16-25(23)32(26-17-7-5-15-24(26)31)27-18-8-10-20-29(27)33(22-12-2-1-3-13-22)30-21-11-9-19-28(30)32/h1-3,8,12,18,22H,4-7,9-11,13-17,19-21H2 |
| InChIKey | RSRWAIGIJCHTKR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |