C43H40N8 — CID 121420357
6-[9-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)pyrimidin-4-yl]-4,4a,7,8-tetrahydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-amine (PubChem CID 121420357) has the molecular formula C43H40N8 and a molecular weight of 668.85 g/mol. Its IUPAC name is 6-[9-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)pyrimidin-4-yl]-4,4a,7,8-tetrahydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-amine.
| Compound Name | 6-[9-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)pyrimidin-4-yl]-4,4a,7,8-tetrahydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-amine |
|---|---|
| PubChem CID | 121420357 |
| Molecular Formula | C43H40N8 |
| Molecular Weight | 668.85 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | 6-[9-[2-(4,6-diphenyl-1,3,5-triazinan-2-yl)pyrimidin-4-yl]-4,4a,7,8-tetrahydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-amine |
| SMILES | Nn1c2c(c3cc(C4=CC=C5C(C4)C4=C(CCC=C4)N5c4ccnc(C5NC(c6ccccc6)NC(c6ccccc6)N5)n4)ccc31)C=CCC2 |
| InChI | InChI=1S/C43H40N8/c44-51-37-18-10-8-16-32(37)34-26-30(20-22-38(34)51)29-19-21-36-33(25-29)31-15-7-9-17-35(31)50(36)39-23-24-45-42(46-39)43-48-40(27-11-3-1-4-12-27)47-41(49-43)28-13-5-2-6-14-28/h1-8,11-16,19-24,26,33,40-41,43,47-49H,9-10,17-18,25,44H2 |
| InChIKey | XOPHLFPRQVMGFC-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |